About (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide
(2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 9108465) has the molecular formula C22H17N3O5
and a molecular weight of 403.39 g/mol. Its IUPAC name is (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| PubChem CID | 9108465 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CN(c2ccc(C(=O)c3ccccc3)cc2[N+](=O)[O-])c2ccccc2O1 |
| InChI | InChI=1S/C22H17N3O5/c23-22(27)20-13-24(17-8-4-5-9-19(17)30-20)16-11-10-15(12-18(16)25(28)29)21(26)14-6-2-1-3-7-14/h1-12,20H,13H2,(H2,23,27)/t20-/m1/s1 |
| InChIKey | GJCYDVPQALSHQZ-HXUWFJFHSA-N |
| XLogP | 3.21 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide?
The IUPAC name of (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (CID 9108465) is (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
What is the SMILES notation for (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide?
The canonical SMILES for (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide is NC(=O)[C@H]1CN(c2ccc(C(=O)c3ccccc3)cc2[N+](=O)[O-])c2ccccc2O1.
What is the InChIKey of (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide?
The InChIKey is GJCYDVPQALSHQZ-HXUWFJFHSA-N. The full InChI is InChI=1S/C22H17N3O5/c23-22(27)20-13-24(17-8-4-5-9-19(17)30-20)16-11-10-15(12-18(16)25(28)29)21(26)14-6-2-1-3-7-14/h1-12,20H,13H2,(H2,23,27)/t20-/m1/s1.
What are the key properties of (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide?
(2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide has a molecular weight of 403.39 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(4-benzoyl-2-nitrophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide is sourced from PubChem (CID 9108465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).