About 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide
2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide (PubChem CID 91085405) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide.
Molecular Properties
| Compound Name | 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide |
| PubChem CID | 91085405 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide |
| SMILES | NC(=O)C(=O)C12CC3CC4CC(C1)C43C2 |
| InChI | InChI=1S/C12H15NO2/c13-10(15)9(14)11-3-7-1-6-2-8(4-11)12(6,7)5-11/h6-8H,1-5H2,(H2,13,15) |
| InChIKey | BBPQYVUDCSLFAK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide?
The IUPAC name of 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide (CID 91085405) is 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide.
What is the SMILES notation for 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide?
The canonical SMILES for 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide is NC(=O)C(=O)C12CC3CC4CC(C1)C43C2.
What is the InChIKey of 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide?
The InChIKey is BBPQYVUDCSLFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c13-10(15)9(14)11-3-7-1-6-2-8(4-11)12(6,7)5-11/h6-8H,1-5H2,(H2,13,15).
What are the key properties of 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide?
2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide has a molecular weight of 205.26 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-(1-tetracyclo[5.2.1.03,8.05,8]decanyl)acetamide is sourced from PubChem (CID 91085405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).