C17H30N2O4 — CID 91085791
N-(3-amino-2,2-dimethyl-4-oxobutyl)-5-formyl-2,2,4,4-tetramethyl-6-oxohexanamide (PubChem CID 91085791) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethyl-4-oxobutyl)-5-formyl-2,2,4,4-tetramethyl-6-oxohexanamide.
| Compound Name | N-(3-amino-2,2-dimethyl-4-oxobutyl)-5-formyl-2,2,4,4-tetramethyl-6-oxohexanamide |
|---|---|
| PubChem CID | 91085791 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | N-(3-amino-2,2-dimethyl-4-oxobutyl)-5-formyl-2,2,4,4-tetramethyl-6-oxohexanamide |
| SMILES | CC(C)(CC(C)(C)C(C=O)C=O)C(=O)NCC(C)(C)C(N)C=O |
| InChI | InChI=1S/C17H30N2O4/c1-15(2,12(7-20)8-21)10-16(3,4)14(23)19-11-17(5,6)13(18)9-22/h7-9,12-13H,10-11,18H2,1-6H3,(H,19,23) |
| InChIKey | XJGFQGIXENCPKF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|