C14H13ClF3NO4 — CID 91086040
4-chloro-2-ethyl-6-(trifluoromethyl)-2,3-dihydroquinoline-1,4-dicarboxylic acid (PubChem CID 91086040) has the molecular formula C14H13ClF3NO4 and a molecular weight of 351.71 g/mol. Its IUPAC name is 4-chloro-2-ethyl-6-(trifluoromethyl)-2,3-dihydroquinoline-1,4-dicarboxylic acid.
| Compound Name | 4-chloro-2-ethyl-6-(trifluoromethyl)-2,3-dihydroquinoline-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 91086040 |
| Molecular Formula | C14H13ClF3NO4 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 4-chloro-2-ethyl-6-(trifluoromethyl)-2,3-dihydroquinoline-1,4-dicarboxylic acid |
| SMILES | CCC1CC(Cl)(C(=O)O)c2cc(C(F)(F)F)ccc2N1C(=O)O |
| InChI | InChI=1S/C14H13ClF3NO4/c1-2-8-6-13(15,11(20)21)9-5-7(14(16,17)18)3-4-10(9)19(8)12(22)23/h3-5,8H,2,6H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | POJOUXBRRJEPNJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|