C27H31N3O4 — CID 91086296
(8R)-8-[[4-[(2,3-dimethylindol-1-yl)methyl]benzoyl]amino]-N-hydroxy-1-oxaspiro[4.4]nonane-7-carboxamide (PubChem CID 91086296) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is (8R)-8-[[4-[(2,3-dimethylindol-1-yl)methyl]benzoyl]amino]-N-hydroxy-1-oxaspiro[4.4]nonane-7-carboxamide.
| Compound Name | (8R)-8-[[4-[(2,3-dimethylindol-1-yl)methyl]benzoyl]amino]-N-hydroxy-1-oxaspiro[4.4]nonane-7-carboxamide |
|---|---|
| PubChem CID | 91086296 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (8R)-8-[[4-[(2,3-dimethylindol-1-yl)methyl]benzoyl]amino]-N-hydroxy-1-oxaspiro[4.4]nonane-7-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(C(=O)N[C@@H]3CC4(CCCO4)CC3C(=O)NO)cc2)c2ccccc12 |
| InChI | InChI=1S/C27H31N3O4/c1-17-18(2)30(24-7-4-3-6-21(17)24)16-19-8-10-20(11-9-19)25(31)28-23-15-27(12-5-13-34-27)14-22(23)26(32)29-33/h3-4,6-11,22-23,33H,5,12-16H2,1-2H3,(H,28,31)(H,29,32)/t22?,23-,27?/m1/s1 |
| InChIKey | VNKJRGKYRZUPHX-ZOCBXBDSSA-N |
| XLogP | 3.87 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|