C12H24F2O7 — CID 91086545
3-[4-[2-(2,3-dihydroxypropoxy)-1,1-difluoroethoxy]butoxy]propane-1,2-diol (PubChem CID 91086545) has the molecular formula C12H24F2O7 and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-[4-[2-(2,3-dihydroxypropoxy)-1,1-difluoroethoxy]butoxy]propane-1,2-diol.
| Compound Name | 3-[4-[2-(2,3-dihydroxypropoxy)-1,1-difluoroethoxy]butoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 91086545 |
| Molecular Formula | C12H24F2O7 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-[4-[2-(2,3-dihydroxypropoxy)-1,1-difluoroethoxy]butoxy]propane-1,2-diol |
| SMILES | OCC(O)COCCCCOC(F)(F)COCC(O)CO |
| InChI | InChI=1S/C12H24F2O7/c13-12(14,9-20-8-11(18)6-16)21-4-2-1-3-19-7-10(17)5-15/h10-11,15-18H,1-9H2 |
| InChIKey | DREKQXAXSGNYQM-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|