C24H17N3O8S2 — CID 91086832
4-[2-[[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoyl]amino]ethylsulfanyl]pyridine-2,6-dicarboxylic acid (PubChem CID 91086832) has the molecular formula C24H17N3O8S2 and a molecular weight of 539.55 g/mol. Its IUPAC name is 4-[2-[[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoyl]amino]ethylsulfanyl]pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-[2-[[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoyl]amino]ethylsulfanyl]pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 91086832 |
| Molecular Formula | C24H17N3O8S2 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 4-[2-[[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoyl]amino]ethylsulfanyl]pyridine-2,6-dicarboxylic acid |
| SMILES | O=C1NC(=O)C(=Cc2ccc(-c3cccc(C(=O)NCCSc4cc(C(=O)O)nc(C(=O)O)c4)c3)o2)S1 |
| InChI | InChI=1S/C24H17N3O8S2/c28-20(25-6-7-36-15-10-16(22(30)31)26-17(11-15)23(32)33)13-3-1-2-12(8-13)18-5-4-14(35-18)9-19-21(29)27-24(34)37-19/h1-5,8-11H,6-7H2,(H,25,28)(H,30,31)(H,32,33)(H,27,29,34) |
| InChIKey | ANHZFXKOZBVQNV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 175.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|