About 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine
1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine (PubChem CID 91086945) has the molecular formula C19H22Cl2N2O2
and a molecular weight of 381.30 g/mol. Its IUPAC name is 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine.
Molecular Properties
| Compound Name | 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine |
| PubChem CID | 91086945 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine |
| SMILES | CCOC1C(OCC)N(c2ccc(Cl)cc2)CN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-3-24-18-19(25-4-2)23(17-11-7-15(21)8-12-17)13-22(18)16-9-5-14(20)6-10-16/h5-12,18-19H,3-4,13H2,1-2H3 |
| InChIKey | MSWJRYPPDATHDX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine?
The IUPAC name of 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine (CID 91086945) is 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine.
What is the SMILES notation for 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine?
The canonical SMILES for 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine is CCOC1C(OCC)N(c2ccc(Cl)cc2)CN1c1ccc(Cl)cc1.
What is the InChIKey of 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine?
The InChIKey is MSWJRYPPDATHDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22Cl2N2O2/c1-3-24-18-19(25-4-2)23(17-11-7-15(21)8-12-17)13-22(18)16-9-5-14(20)6-10-16/h5-12,18-19H,3-4,13H2,1-2H3.
What are the key properties of 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine?
1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine has a molecular weight of 381.30 g/mol, XLogP of 5.00, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine is sourced from PubChem (CID 91086945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).