C30H28N4O2 — CID 91087016
4-(2-cyanophenyl)-2-methyl-N-[2-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]benzamide;ethane (PubChem CID 91087016) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 4-(2-cyanophenyl)-2-methyl-N-[2-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]benzamide;ethane.
| Compound Name | 4-(2-cyanophenyl)-2-methyl-N-[2-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]benzamide;ethane |
|---|---|
| PubChem CID | 91087016 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 4-(2-cyanophenyl)-2-methyl-N-[2-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]benzamide;ethane |
| SMILES | CC.Cc1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(-c3ccccc3C#N)cc2C)nc1 |
| InChI | InChI=1S/C28H22N4O2.C2H6/c1-18-11-14-26(30-17-18)32-28(34)24-9-5-6-10-25(24)31-27(33)22-13-12-20(15-19(22)2)23-8-4-3-7-21(23)16-29;1-2/h3-15,17H,1-2H3,(H,31,33)(H,30,32,34);1-2H3 |
| InChIKey | OYMOXJNVSGDUIF-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |