C9H11NO9 — CID 91087065
2-amino-2,3-dihydroxy-3-(2,3,4,5,6-pentahydroxyphenyl)propanoic acid (PubChem CID 91087065) has the molecular formula C9H11NO9 and a molecular weight of 277.19 g/mol. Its IUPAC name is 2-amino-2,3-dihydroxy-3-(2,3,4,5,6-pentahydroxyphenyl)propanoic acid.
| Compound Name | 2-amino-2,3-dihydroxy-3-(2,3,4,5,6-pentahydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 91087065 |
| Molecular Formula | C9H11NO9 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-amino-2,3-dihydroxy-3-(2,3,4,5,6-pentahydroxyphenyl)propanoic acid |
| SMILES | NC(O)(C(=O)O)C(O)c1c(O)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C9H11NO9/c10-9(19,8(17)18)7(16)1-2(11)4(13)6(15)5(14)3(1)12/h7,11-16,19H,10H2,(H,17,18) |
| InChIKey | ZBVPTYYMEFFAIK-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 204.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|