C27H26N2O3S2 — CID 91087822
N-(4-methylsulfanylphenyl)-3-[6-(1-methylsulfonylpropyl)quinolin-8-yl]benzamide (PubChem CID 91087822) has the molecular formula C27H26N2O3S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-3-[6-(1-methylsulfonylpropyl)quinolin-8-yl]benzamide.
| Compound Name | N-(4-methylsulfanylphenyl)-3-[6-(1-methylsulfonylpropyl)quinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 91087822 |
| Molecular Formula | C27H26N2O3S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-3-[6-(1-methylsulfonylpropyl)quinolin-8-yl]benzamide |
| SMILES | CCC(c1cc(-c2cccc(C(=O)Nc3ccc(SC)cc3)c2)c2ncccc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C27H26N2O3S2/c1-4-25(34(3,31)32)21-16-19-9-6-14-28-26(19)24(17-21)18-7-5-8-20(15-18)27(30)29-22-10-12-23(33-2)13-11-22/h5-17,25H,4H2,1-3H3,(H,29,30) |
| InChIKey | SCWZWSQFQPKUAZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |