C11H16F9N — CID 91087872
N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]heptan-1-amine (PubChem CID 91087872) has the molecular formula C11H16F9N and a molecular weight of 333.24 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]heptan-1-amine.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]heptan-1-amine |
|---|---|
| PubChem CID | 91087872 |
| Molecular Formula | C11H16F9N |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]heptan-1-amine |
| SMILES | CCCCCCCNC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H16F9N/c1-2-3-4-5-6-7-21-8(9(12,13)14,10(15,16)17)11(18,19)20/h21H,2-7H2,1H3 |
| InChIKey | PXPKYCSHXFLIJC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|