C27H27F3O2S — CID 91088096
[2-methyl-4-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]pentyl]sulfanylphenyl] acetate (PubChem CID 91088096) has the molecular formula C27H27F3O2S and a molecular weight of 472.57 g/mol. Its IUPAC name is [2-methyl-4-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]pentyl]sulfanylphenyl] acetate.
| Compound Name | [2-methyl-4-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]pentyl]sulfanylphenyl] acetate |
|---|---|
| PubChem CID | 91088096 |
| Molecular Formula | C27H27F3O2S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [2-methyl-4-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]pentyl]sulfanylphenyl] acetate |
| SMILES | CCCC[C@H](Sc1ccc(OC(C)=O)c(C)c1)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H27F3O2S/c1-4-5-6-26(33-24-15-16-25(18(2)17-24)32-19(3)31)22-9-7-20(8-10-22)21-11-13-23(14-12-21)27(28,29)30/h7-17,26H,4-6H2,1-3H3/t26-/m0/s1 |
| InChIKey | BUUHUEYGNZSGEQ-SANMLTNESA-N |
| XLogP | 8.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|