About (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine
(5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine (PubChem CID 910881) has the molecular formula C22H20N2O2
and a molecular weight of 344.41 g/mol. Its IUPAC name is (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine.
Molecular Properties
| Compound Name | (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine |
| PubChem CID | 910881 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine |
| SMILES | c1ccc(/N=C2\O[C@@H](COc3ccccc3)CN2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O2/c1-4-10-18(11-5-1)23-22-24(19-12-6-2-7-13-19)16-21(26-22)17-25-20-14-8-3-9-15-20/h1-15,21H,16-17H2/b23-22-/t21-/m1/s1 |
| InChIKey | OYWOXRIHKJOTHN-XSSWQJIQSA-N |
| XLogP | 4.66 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine?
The IUPAC name of (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine (CID 910881) is (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine.
What is the SMILES notation for (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine?
The canonical SMILES for (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine is c1ccc(/N=C2\O[C@@H](COc3ccccc3)CN2c2ccccc2)cc1.
What is the InChIKey of (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine?
The InChIKey is OYWOXRIHKJOTHN-XSSWQJIQSA-N. The full InChI is InChI=1S/C22H20N2O2/c1-4-10-18(11-5-1)23-22-24(19-12-6-2-7-13-19)16-21(26-22)17-25-20-14-8-3-9-15-20/h1-15,21H,16-17H2/b23-22-/t21-/m1/s1.
What are the key properties of (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine?
(5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine has a molecular weight of 344.41 g/mol, XLogP of 4.66, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(phenoxymethyl)-N,3-diphenyl-1,3-oxazolidin-2-imine is sourced from PubChem (CID 910881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).