C44H32Br8N8+4 — CID 91088190
2,3,7,8,12,13,17,18-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91088190) has the molecular formula C44H32Br8N8+4 and a molecular weight of 1312.03 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91088190 |
| Molecular Formula | C44H32Br8N8+4 |
| Molecular Weight | 1312.03 g/mol |
| Exact Mass | 1303.62 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | C[n+]1ccc(C2=c3[nH]c(c(Br)c3Br)=C(c3cc[n+](C)cc3)c3[nH]c(c(Br)c3Br)C(c3cc[n+](C)cc3)=c3[nH]c(c(Br)c3Br)=C(c3cc[n+](C)cc3)c3[nH]c2c(Br)c3Br)cc1 |
| InChI | InChI=1S/C44H30Br8N8/c1-57-13-5-21(6-14-57)25-37-29(45)31(47)39(53-37)26(22-7-15-58(2)16-8-22)41-33(49)35(51)43(55-41)28(24-11-19-60(4)20-12-24)44-36(52)34(50)42(56-44)27(23-9-17-59(3)18-10-23)40-32(48)30(46)38(25)54-40/h5-20H,1-4H3,(H2,53,54,55,56)/q+2/p+2 |
| InChIKey | RSSRROFZYBJWBY-UHFFFAOYSA-P |
| XLogP | 7.70 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1312.03 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|