About 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide
4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide (PubChem CID 9108843) has the molecular formula C15H13N3O2S
and a molecular weight of 299.36 g/mol. Its IUPAC name is 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide.
Molecular Properties
| Compound Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide |
| PubChem CID | 9108843 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide |
| SMILES | Cc1sc2ncnc(Oc3ccc(C(N)=O)cc3)c2c1C |
| InChI | InChI=1S/C15H13N3O2S/c1-8-9(2)21-15-12(8)14(17-7-18-15)20-11-5-3-10(4-6-11)13(16)19/h3-7H,1-2H3,(H2,16,19) |
| InChIKey | UOHTUDGPDCLBOW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide?
The IUPAC name of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide (CID 9108843) is 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide.
What is the SMILES notation for 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide?
The canonical SMILES for 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide is Cc1sc2ncnc(Oc3ccc(C(N)=O)cc3)c2c1C.
What is the InChIKey of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide?
The InChIKey is UOHTUDGPDCLBOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O2S/c1-8-9(2)21-15-12(8)14(17-7-18-15)20-11-5-3-10(4-6-11)13(16)19/h3-7H,1-2H3,(H2,16,19).
What are the key properties of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide?
4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide has a molecular weight of 299.36 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide is sourced from PubChem (CID 9108843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).