About 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea
1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea (PubChem CID 91088909) has the molecular formula C16H22N5O+
and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea.
Molecular Properties
| Compound Name | 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea |
| PubChem CID | 91088909 |
| Molecular Formula | C16H22N5O+ |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea |
| SMILES | C[n+]1cc(NC(=O)NC2CCCC3(CC3)C2)nc2cc[nH]c21 |
| InChI | InChI=1S/C16H21N5O/c1-21-10-13(19-12-4-8-17-14(12)21)20-15(22)18-11-3-2-5-16(9-11)6-7-16/h4,8,10-11H,2-3,5-7,9H2,1H3,(H2,18,20,22)/p+1 |
| InChIKey | MRFYXEHHIUPSNT-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea?
The IUPAC name of 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea (CID 91088909) is 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea.
What is the SMILES notation for 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea?
The canonical SMILES for 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea is C[n+]1cc(NC(=O)NC2CCCC3(CC3)C2)nc2cc[nH]c21.
What is the InChIKey of 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea?
The InChIKey is MRFYXEHHIUPSNT-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H21N5O/c1-21-10-13(19-12-4-8-17-14(12)21)20-15(22)18-11-3-2-5-16(9-11)6-7-16/h4,8,10-11H,2-3,5-7,9H2,1H3,(H2,18,20,22)/p+1.
What are the key properties of 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea?
1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea has a molecular weight of 300.39 g/mol, XLogP of 2.23, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-2-yl)-3-spiro[2.5]octan-7-ylurea is sourced from PubChem (CID 91088909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).