About 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid
2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid (PubChem CID 91088963) has the molecular formula C30H21ClN2O5
and a molecular weight of 524.96 g/mol. Its IUPAC name is 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid |
| PubChem CID | 91088963 |
| Molecular Formula | C30H21ClN2O5 |
| Molecular Weight | 524.96 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C1c2cc(Cl)c(O)cc2Oc2c1ccc(O)c2CNc1cccc2cccnc12 |
| InChI | InChI=1S/C30H21ClN2O5/c31-22-13-20-26(14-25(22)35)38-29-19(27(20)17-7-1-2-8-18(17)30(36)37)10-11-24(34)21(29)15-33-23-9-3-5-16-6-4-12-32-28(16)23/h1-14,27,33-35H,15H2,(H,36,37) |
| InChIKey | DBNZGRXBVPKOGE-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.96 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid?
The IUPAC name of 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid (CID 91088963) is 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid.
What is the SMILES notation for 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid?
The canonical SMILES for 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid is O=C(O)c1ccccc1C1c2cc(Cl)c(O)cc2Oc2c1ccc(O)c2CNc1cccc2cccnc12.
What is the InChIKey of 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid?
The InChIKey is DBNZGRXBVPKOGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21ClN2O5/c31-22-13-20-26(14-25(22)35)38-29-19(27(20)17-7-1-2-8-18(17)30(36)37)10-11-24(34)21(29)15-33-23-9-3-5-16-6-4-12-32-28(16)23/h1-14,27,33-35H,15H2,(H,36,37).
What are the key properties of 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid?
2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid has a molecular weight of 524.96 g/mol, XLogP of 6.90, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-3,6-dihydroxy-5-[(quinolin-8-ylamino)methyl]-9H-xanthen-9-yl]benzoic acid is sourced from PubChem (CID 91088963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).