C32H32ClN5O2S — CID 91089434
N-benzyl-N-[[13-chloro-2-(4-methylsulfonylpiperazin-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl]pyridin-2-amine (PubChem CID 91089434) has the molecular formula C32H32ClN5O2S and a molecular weight of 586.16 g/mol. Its IUPAC name is N-benzyl-N-[[13-chloro-2-(4-methylsulfonylpiperazin-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl]pyridin-2-amine.
| Compound Name | N-benzyl-N-[[13-chloro-2-(4-methylsulfonylpiperazin-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 91089434 |
| Molecular Formula | C32H32ClN5O2S |
| Molecular Weight | 586.16 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | N-benzyl-N-[[13-chloro-2-(4-methylsulfonylpiperazin-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl]pyridin-2-amine |
| SMILES | CS(=O)(=O)N1CCN(C2c3ccc(Cl)cc3C=C(CN(Cc3ccccc3)c3ccccn3)c3cccnc32)CC1 |
| InChI | InChI=1S/C32H32ClN5O2S/c1-41(39,40)38-18-16-36(17-19-38)32-29-13-12-27(33)21-25(29)20-26(28-10-7-15-35-31(28)32)23-37(30-11-5-6-14-34-30)22-24-8-3-2-4-9-24/h2-15,20-21,32H,16-19,22-23H2,1H3 |
| InChIKey | CZQRRRDHDNIGOF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.16 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |