C20H16ClFN4O — CID 91089789
4-N-[2-chloro-2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]ethyl]quinoline-3,4-diamine (PubChem CID 91089789) has the molecular formula C20H16ClFN4O and a molecular weight of 382.83 g/mol. Its IUPAC name is 4-N-[2-chloro-2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]ethyl]quinoline-3,4-diamine.
| Compound Name | 4-N-[2-chloro-2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]ethyl]quinoline-3,4-diamine |
|---|---|
| PubChem CID | 91089789 |
| Molecular Formula | C20H16ClFN4O |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-N-[2-chloro-2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]ethyl]quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NCC(Cl)c1cc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C20H16ClFN4O/c21-15(19-9-18(26-27-19)12-5-7-13(22)8-6-12)10-25-20-14-3-1-2-4-17(14)24-11-16(20)23/h1-9,11,15H,10,23H2,(H,24,25) |
| InChIKey | LNJKPPOYRVAKCU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|