About ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine
ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 91090169) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine.
Molecular Properties
| Compound Name | ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine |
| PubChem CID | 91090169 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | CC.CC1(N)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C9H17NO2.C2H6/c1-8(10)2-4-9(5-3-8)11-6-7-12-9;1-2/h2-7,10H2,1H3;1-2H3 |
| InChIKey | OXWYCSOEJZPLFX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine?
The IUPAC name of ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine (CID 91090169) is ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine.
What is the SMILES notation for ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine?
The canonical SMILES for ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine is CC.CC1(N)CCC2(CC1)OCCO2.
What is the InChIKey of ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine?
The InChIKey is OXWYCSOEJZPLFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C2H6/c1-8(10)2-4-9(5-3-8)11-6-7-12-9;1-2/h2-7,10H2,1H3;1-2H3.
What are the key properties of ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine?
ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine has a molecular weight of 201.31 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-amine is sourced from PubChem (CID 91090169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).