C24H40O6 — CID 91090228
(5R)-3-hydroxy-5-[(1S)-1-hydroxy-2-octadeca-9,12-dien-4-yloxyethyl]oxolane-2,4-dione (PubChem CID 91090228) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is (5R)-3-hydroxy-5-[(1S)-1-hydroxy-2-octadeca-9,12-dien-4-yloxyethyl]oxolane-2,4-dione.
| Compound Name | (5R)-3-hydroxy-5-[(1S)-1-hydroxy-2-octadeca-9,12-dien-4-yloxyethyl]oxolane-2,4-dione |
|---|---|
| PubChem CID | 91090228 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (5R)-3-hydroxy-5-[(1S)-1-hydroxy-2-octadeca-9,12-dien-4-yloxyethyl]oxolane-2,4-dione |
| SMILES | CCCCCC=CCC=CCCCCC(CCC)OC[C@H](O)[C@H]1OC(=O)C(O)C1=O |
| InChI | InChI=1S/C24H40O6/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-19(16-4-2)29-18-20(25)23-21(26)22(27)24(28)30-23/h8-9,11-12,19-20,22-23,25,27H,3-7,10,13-18H2,1-2H3/t19?,20-,22?,23+/m0/s1 |
| InChIKey | AGEMPNBRHSITCN-VNMGMYBJSA-N |
| XLogP | 4.03 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|