C23H19FN4O6 — CID 91090452
5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(3-oxo-1,2,4,5-tetrahydrofuro[3,2-e]isoindol-7-yl)imidazolidine-2,4-dione (PubChem CID 91090452) has the molecular formula C23H19FN4O6 and a molecular weight of 466.43 g/mol. Its IUPAC name is 5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(3-oxo-1,2,4,5-tetrahydrofuro[3,2-e]isoindol-7-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(3-oxo-1,2,4,5-tetrahydrofuro[3,2-e]isoindol-7-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91090452 |
| Molecular Formula | C23H19FN4O6 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(3-oxo-1,2,4,5-tetrahydrofuro[3,2-e]isoindol-7-yl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1F)C(=O)N(CC1(c3cc4c(o3)CCC3=C4CNC3=O)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C23H19FN4O6/c1-33-15-4-2-10-8-28(20(30)17(10)18(15)24)9-23(21(31)26-22(32)27-23)16-6-12-13-7-25-19(29)11(13)3-5-14(12)34-16/h2,4,6H,3,5,7-9H2,1H3,(H,25,29)(H2,26,27,31,32) |
| InChIKey | MASZHKBLMGOYPQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|