About 9,9-dimethylundeca-4,6-diene-3,8-dione
9,9-dimethylundeca-4,6-diene-3,8-dione (PubChem CID 91090491) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 9,9-dimethylundeca-4,6-diene-3,8-dione.
Molecular Properties
| Compound Name | 9,9-dimethylundeca-4,6-diene-3,8-dione |
| PubChem CID | 91090491 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 9,9-dimethylundeca-4,6-diene-3,8-dione |
| SMILES | CCC(=O)C=CC=CC(=O)C(C)(C)CC |
| InChI | InChI=1S/C13H20O2/c1-5-11(14)9-7-8-10-12(15)13(3,4)6-2/h7-10H,5-6H2,1-4H3 |
| InChIKey | REUAUSWSJUSXDA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 9,9-dimethylundeca-4,6-diene-3,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethylundeca-4,6-diene-3,8-dione?
The IUPAC name of 9,9-dimethylundeca-4,6-diene-3,8-dione (CID 91090491) is 9,9-dimethylundeca-4,6-diene-3,8-dione.
What is the SMILES notation for 9,9-dimethylundeca-4,6-diene-3,8-dione?
The canonical SMILES for 9,9-dimethylundeca-4,6-diene-3,8-dione is CCC(=O)C=CC=CC(=O)C(C)(C)CC.
What is the InChIKey of 9,9-dimethylundeca-4,6-diene-3,8-dione?
The InChIKey is REUAUSWSJUSXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-5-11(14)9-7-8-10-12(15)13(3,4)6-2/h7-10H,5-6H2,1-4H3.
What are the key properties of 9,9-dimethylundeca-4,6-diene-3,8-dione?
9,9-dimethylundeca-4,6-diene-3,8-dione has a molecular weight of 208.30 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethylundeca-4,6-diene-3,8-dione is sourced from PubChem (CID 91090491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).