C11H10F7NS — CID 91090593
4-(1,1,1,2,4,4,4-heptafluorobutan-2-yl)-2-methylsulfanylaniline (PubChem CID 91090593) has the molecular formula C11H10F7NS and a molecular weight of 321.26 g/mol. Its IUPAC name is 4-(1,1,1,2,4,4,4-heptafluorobutan-2-yl)-2-methylsulfanylaniline.
| Compound Name | 4-(1,1,1,2,4,4,4-heptafluorobutan-2-yl)-2-methylsulfanylaniline |
|---|---|
| PubChem CID | 91090593 |
| Molecular Formula | C11H10F7NS |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-(1,1,1,2,4,4,4-heptafluorobutan-2-yl)-2-methylsulfanylaniline |
| SMILES | CSc1cc(C(F)(CC(F)(F)F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C11H10F7NS/c1-20-8-4-6(2-3-7(8)19)9(12,11(16,17)18)5-10(13,14)15/h2-4H,5,19H2,1H3 |
| InChIKey | RZVWKLCAPDCFKA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|