About 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol
3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol (PubChem CID 91091321) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol.
Molecular Properties
| Compound Name | 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol |
| PubChem CID | 91091321 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol |
| SMILES | CCO.Cc1c(C)c(=O)c1=O |
| InChI | InChI=1S/C6H6O2.C2H6O/c1-3-4(2)6(8)5(3)7;1-2-3/h1-2H3;3H,2H2,1H3 |
| InChIKey | UVZMBZLKEXRJMN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol?
The IUPAC name of 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol (CID 91091321) is 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol.
What is the SMILES notation for 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol?
The canonical SMILES for 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol is CCO.Cc1c(C)c(=O)c1=O.
What is the InChIKey of 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol?
The InChIKey is UVZMBZLKEXRJMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C2H6O/c1-3-4(2)6(8)5(3)7;1-2-3/h1-2H3;3H,2H2,1H3.
What are the key properties of 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol?
3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol has a molecular weight of 156.18 g/mol, XLogP of -0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylcyclobut-3-ene-1,2-dione;ethanol is sourced from PubChem (CID 91091321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).