C18H17NO5S — CID 91091354
5-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-ylmethylideneamino)oxyethyl]thiophene-2-carboxylic acid (PubChem CID 91091354) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is 5-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-ylmethylideneamino)oxyethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-ylmethylideneamino)oxyethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 91091354 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 5-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-ylmethylideneamino)oxyethyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(CC2=CC=CCC2)ON=CC2=COC=CO2)s1 |
| InChI | InChI=1S/C18H17NO5S/c20-18(21)17-7-6-16(25-17)15(10-13-4-2-1-3-5-13)24-19-11-14-12-22-8-9-23-14/h1-2,4,6-9,11-12,15H,3,5,10H2,(H,20,21) |
| InChIKey | ARPCGKVPYYIEEU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|