C24H27N9O — CID 91091904
3-[[3-[5-[1-imino-3-(2-methoxyethylimino)propan-2-yl]pyrimidin-2-yl]phenyl]methyl]-N,N-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 91091904) has the molecular formula C24H27N9O and a molecular weight of 457.54 g/mol. Its IUPAC name is 3-[[3-[5-[1-imino-3-(2-methoxyethylimino)propan-2-yl]pyrimidin-2-yl]phenyl]methyl]-N,N-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-[[3-[5-[1-imino-3-(2-methoxyethylimino)propan-2-yl]pyrimidin-2-yl]phenyl]methyl]-N,N-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 91091904 |
| Molecular Formula | C24H27N9O |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 3-[[3-[5-[1-imino-3-(2-methoxyethylimino)propan-2-yl]pyrimidin-2-yl]phenyl]methyl]-N,N-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | [H]/N=C/C(/C=N/CCOC)c1cnc(-c2cccc(Cc3nnc4ccc(N(C)C)nn34)c2)nc1 |
| InChI | InChI=1S/C24H27N9O/c1-32(2)22-8-7-21-29-30-23(33(21)31-22)12-17-5-4-6-18(11-17)24-27-15-20(16-28-24)19(13-25)14-26-9-10-34-3/h4-8,11,13-16,19,25H,9-10,12H2,1-3H3/b25-13+,26-14+ |
| InChIKey | JXXDYRPUUZHUKI-BKHCZYBLSA-N |
| XLogP | 2.69 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|