C11H14N3O3- — CID 91092011
1-[[[2-(2-methylidene-5-oxopyrrol-1-yl)acetyl]amino]methylamino]prop-1-en-1-olate (PubChem CID 91092011) has the molecular formula C11H14N3O3- and a molecular weight of 236.25 g/mol. Its IUPAC name is 1-[[[2-(2-methylidene-5-oxopyrrol-1-yl)acetyl]amino]methylamino]prop-1-en-1-olate.
| Compound Name | 1-[[[2-(2-methylidene-5-oxopyrrol-1-yl)acetyl]amino]methylamino]prop-1-en-1-olate |
|---|---|
| PubChem CID | 91092011 |
| Molecular Formula | C11H14N3O3- |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-[[[2-(2-methylidene-5-oxopyrrol-1-yl)acetyl]amino]methylamino]prop-1-en-1-olate |
| SMILES | C=C1C=CC(=O)N1CC(=O)NCNC([O-])=CC |
| InChI | InChI=1S/C11H15N3O3/c1-3-9(15)12-7-13-10(16)6-14-8(2)4-5-11(14)17/h3-5,12,15H,2,6-7H2,1H3,(H,13,16)/p-1 |
| InChIKey | OPPVRMSLVBEIFC-UHFFFAOYSA-M |
| XLogP | -1.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|