C27H25ClFN7O2 — CID 91092094
N-[3-(3-chloro-5-methylphenoxy)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine (PubChem CID 91092094) has the molecular formula C27H25ClFN7O2 and a molecular weight of 534.00 g/mol. Its IUPAC name is N-[3-(3-chloro-5-methylphenoxy)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine.
| Compound Name | N-[3-(3-chloro-5-methylphenoxy)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 91092094 |
| Molecular Formula | C27H25ClFN7O2 |
| Molecular Weight | 534.00 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | N-[3-(3-chloro-5-methylphenoxy)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
| SMILES | Cc1cc(Cl)cc(Oc2cccc(Nc3ccc(C/N=N/c4ncc(F)c(N5CCOCC5)n4)nc3)c2)c1 |
| InChI | InChI=1S/C27H25ClFN7O2/c1-18-11-19(28)13-24(12-18)38-23-4-2-3-20(14-23)33-22-6-5-21(30-15-22)16-32-35-27-31-17-25(29)26(34-27)36-7-9-37-10-8-36/h2-6,11-15,17,33H,7-10,16H2,1H3/b35-32+ |
| InChIKey | SZCBJCVRWISXOU-LVYIWIAJSA-N |
| XLogP | 6.63 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.00 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|