C30H44O7 — CID 91092290
ethyl (9R,10R,13R,14S,17R)-12-acetyloxy-17-[(2R)-5-methoxy-5-oxopentan-2-yl]-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 91092290) has the molecular formula C30H44O7 and a molecular weight of 516.68 g/mol. Its IUPAC name is ethyl (9R,10R,13R,14S,17R)-12-acetyloxy-17-[(2R)-5-methoxy-5-oxopentan-2-yl]-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | ethyl (9R,10R,13R,14S,17R)-12-acetyloxy-17-[(2R)-5-methoxy-5-oxopentan-2-yl]-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 91092290 |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | ethyl (9R,10R,13R,14S,17R)-12-acetyloxy-17-[(2R)-5-methoxy-5-oxopentan-2-yl]-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | CCOC(=O)C1CC[C@@]2(C)C(C1)C(=O)C=C1[C@@H]3CC[C@H]([C@H](C)CCC(=O)OC)[C@@]3(C)C(OC(C)=O)C[C@@H]12 |
| InChI | InChI=1S/C30H44O7/c1-7-36-28(34)19-12-13-29(4)23-16-26(37-18(3)31)30(5)21(17(2)8-11-27(33)35-6)9-10-22(30)20(23)15-25(32)24(29)14-19/h15,17,19,21-24,26H,7-14,16H2,1-6H3/t17-,19?,21-,22+,23+,24?,26?,29-,30-/m1/s1 |
| InChIKey | OHELRONKZMFQHK-XCPWBNCLSA-N |
| XLogP | 5.05 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|