C26H28FN3O3S — CID 91092789
(1'R,4R,10'S)-5'-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-2-propylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide (PubChem CID 91092789) has the molecular formula C26H28FN3O3S and a molecular weight of 481.59 g/mol. Its IUPAC name is (1'R,4R,10'S)-5'-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-2-propylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide.
| Compound Name | (1'R,4R,10'S)-5'-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-2-propylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
|---|---|
| PubChem CID | 91092789 |
| Molecular Formula | C26H28FN3O3S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (1'R,4R,10'S)-5'-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-2-propylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
| SMILES | CCCN1C[C@]2(NS1(=O)=O)[C@@H]1CC[C@H]2Cc2ccc(-c3ncc(-c4ccc(F)cc4)o3)cc2C1 |
| InChI | InChI=1S/C26H28FN3O3S/c1-2-11-30-16-26(29-34(30,31)32)21-7-8-22(26)14-20-12-19(4-3-18(20)13-21)25-28-15-24(33-25)17-5-9-23(27)10-6-17/h3-6,9-10,12,15,21-22,29H,2,7-8,11,13-14,16H2,1H3/t21-,22+,26+/m0/s1 |
| InChIKey | DSKWPRCCMRGQMP-VVZHRXSXSA-N |
| XLogP | 4.57 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |