About 8-ethyl-6,7-dihydroisoquinoline
8-ethyl-6,7-dihydroisoquinoline (PubChem CID 91093281) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 8-ethyl-6,7-dihydroisoquinoline.
Molecular Properties
| Compound Name | 8-ethyl-6,7-dihydroisoquinoline |
| PubChem CID | 91093281 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 8-ethyl-6,7-dihydroisoquinoline |
| SMILES | CCC1=c2cnccc2=CCC1 |
| InChI | InChI=1S/C11H13N/c1-2-9-4-3-5-10-6-7-12-8-11(9)10/h5-8H,2-4H2,1H3 |
| InChIKey | FSHSSPBLKOYHRX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-ethyl-6,7-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-6,7-dihydroisoquinoline?
The IUPAC name of 8-ethyl-6,7-dihydroisoquinoline (CID 91093281) is 8-ethyl-6,7-dihydroisoquinoline.
What is the SMILES notation for 8-ethyl-6,7-dihydroisoquinoline?
The canonical SMILES for 8-ethyl-6,7-dihydroisoquinoline is CCC1=c2cnccc2=CCC1.
What is the InChIKey of 8-ethyl-6,7-dihydroisoquinoline?
The InChIKey is FSHSSPBLKOYHRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-2-9-4-3-5-10-6-7-12-8-11(9)10/h5-8H,2-4H2,1H3.
What are the key properties of 8-ethyl-6,7-dihydroisoquinoline?
8-ethyl-6,7-dihydroisoquinoline has a molecular weight of 159.23 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-6,7-dihydroisoquinoline is sourced from PubChem (CID 91093281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).