C40H58SSi — CID 91093836
[4-(4-tert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethyl-[2-methyl-3-(2-methylphenyl)-5-propan-2-yl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl]silane (PubChem CID 91093836) has the molecular formula C40H58SSi and a molecular weight of 599.06 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethyl-[2-methyl-3-(2-methylphenyl)-5-propan-2-yl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl]silane.
| Compound Name | [4-(4-tert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethyl-[2-methyl-3-(2-methylphenyl)-5-propan-2-yl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl]silane |
|---|---|
| PubChem CID | 91093836 |
| Molecular Formula | C40H58SSi |
| Molecular Weight | 599.06 g/mol |
| Exact Mass | 598.40 |
| IUPAC Name | [4-(4-tert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethyl-[2-methyl-3-(2-methylphenyl)-5-propan-2-yl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl]silane |
| SMILES | CC1=C(c2ccccc2C)C2CC(C(C)C)C([Si](C)(C)C3C(C)CC4C(c5ccc(C(C)(C)C)cc5)CCCC43)C2S1 |
| InChI | InChI=1S/C40H58SSi/c1-24(2)33-23-35-36(30-15-12-11-14-25(30)3)27(5)41-37(35)39(33)42(9,10)38-26(4)22-34-31(16-13-17-32(34)38)28-18-20-29(21-19-28)40(6,7)8/h11-12,14-15,18-21,24,26,31-35,37-39H,13,16-17,22-23H2,1-10H3 |
| InChIKey | IFFJTXZWEDRDPS-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.06 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|