C16H15FN2OS — CID 91093919
7-(3-fluorophenoxy)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine (PubChem CID 91093919) has the molecular formula C16H15FN2OS and a molecular weight of 302.37 g/mol. Its IUPAC name is 7-(3-fluorophenoxy)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine.
| Compound Name | 7-(3-fluorophenoxy)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine |
|---|---|
| PubChem CID | 91093919 |
| Molecular Formula | C16H15FN2OS |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 7-(3-fluorophenoxy)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine |
| SMILES | Fc1cccc(Oc2ccc3c(c2)SNC2CCCN32)c1 |
| InChI | InChI=1S/C16H15FN2OS/c17-11-3-1-4-12(9-11)20-13-6-7-14-15(10-13)21-18-16-5-2-8-19(14)16/h1,3-4,6-7,9-10,16,18H,2,5,8H2 |
| InChIKey | ADIFAWRHZLMUFB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|