About 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride
5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride (PubChem CID 91093955) has the molecular formula C8H7Cl3N3O4P
and a molecular weight of 346.49 g/mol. Its IUPAC name is 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride.
Molecular Properties
| Compound Name | 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride |
| PubChem CID | 91093955 |
| Molecular Formula | C8H7Cl3N3O4P |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride |
| SMILES | CC(=O)Cn1c(C#N)c[nH]c(=O)c1=O.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H7N3O3.Cl3OP/c1-5(12)4-11-6(2-9)3-10-7(13)8(11)14;1-5(2,3)4/h3H,4H2,1H3,(H,10,13); |
| InChIKey | JDDONJJVQMVNMG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride?
The IUPAC name of 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride (CID 91093955) is 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride.
What is the SMILES notation for 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride?
The canonical SMILES for 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride is CC(=O)Cn1c(C#N)c[nH]c(=O)c1=O.O=P(Cl)(Cl)Cl.
What is the InChIKey of 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride?
The InChIKey is JDDONJJVQMVNMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3.Cl3OP/c1-5(12)4-11-6(2-9)3-10-7(13)8(11)14;1-5(2,3)4/h3H,4H2,1H3,(H,10,13);.
What are the key properties of 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride?
5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride has a molecular weight of 346.49 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dioxo-4-(2-oxopropyl)-1H-pyrazine-3-carbonitrile;phosphoryl trichloride is sourced from PubChem (CID 91093955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).