C10H12F3N3O5 — CID 91094399
N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,2,2-trifluoroacetamide;methyl carbamate (PubChem CID 91094399) has the molecular formula C10H12F3N3O5 and a molecular weight of 311.22 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,2,2-trifluoroacetamide;methyl carbamate.
| Compound Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,2,2-trifluoroacetamide;methyl carbamate |
|---|---|
| PubChem CID | 91094399 |
| Molecular Formula | C10H12F3N3O5 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,2,2-trifluoroacetamide;methyl carbamate |
| SMILES | COC(N)=O.O=C1C=CC(=O)N1CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H7F3N2O3.C2H5NO2/c9-8(10,11)7(16)12-3-4-13-5(14)1-2-6(13)15;1-5-2(3)4/h1-2H,3-4H2,(H,12,16);1H3,(H2,3,4) |
| InChIKey | PLOITAPGHDUZIK-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|