C33H40N4 — CID 91094436
1-(2,4,6-trimethylphenyl)-3-[2,4,6-trimethyl-3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenyl]-2H-imidazole (PubChem CID 91094436) has the molecular formula C33H40N4 and a molecular weight of 492.71 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)-3-[2,4,6-trimethyl-3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenyl]-2H-imidazole.
| Compound Name | 1-(2,4,6-trimethylphenyl)-3-[2,4,6-trimethyl-3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenyl]-2H-imidazole |
|---|---|
| PubChem CID | 91094436 |
| Molecular Formula | C33H40N4 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)-3-[2,4,6-trimethyl-3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenyl]-2H-imidazole |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)c(N4C=CN(c5c(C)cc(C)cc5C)C4)c3C)C2)c(C)c1 |
| InChI | InChI=1S/C33H40N4/c1-21-14-23(3)30(24(4)15-21)34-10-12-36(19-34)32-27(7)18-28(8)33(29(32)9)37-13-11-35(20-37)31-25(5)16-22(2)17-26(31)6/h10-18H,19-20H2,1-9H3 |
| InChIKey | OZNPQZZJBPDGQI-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |