C25H34O7 — CID 91094871
3-[(1R,2S,9R,10R,11R,14R,15S,17R)-14-hydroxy-9-methoxycarbonyl-2,10,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-en-14-yl]propanoic acid (PubChem CID 91094871) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is 3-[(1R,2S,9R,10R,11R,14R,15S,17R)-14-hydroxy-9-methoxycarbonyl-2,10,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-en-14-yl]propanoic acid.
| Compound Name | 3-[(1R,2S,9R,10R,11R,14R,15S,17R)-14-hydroxy-9-methoxycarbonyl-2,10,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 91094871 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 3-[(1R,2S,9R,10R,11R,14R,15S,17R)-14-hydroxy-9-methoxycarbonyl-2,10,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-en-14-yl]propanoic acid |
| SMILES | COC(=O)[C@@H]1C=C2CC(=O)CC[C@]2(C)[C@@]23O[C@@H]2C[C@@]2(C)[C@@H](CC[C@@]2(O)CCC(=O)O)[C@]13C |
| InChI | InChI=1S/C25H34O7/c1-21-8-5-15(26)11-14(21)12-16(20(29)31-4)23(3)17-6-9-24(30,10-7-19(27)28)22(17,2)13-18-25(21,23)32-18/h12,16-18,30H,5-11,13H2,1-4H3,(H,27,28)/t16-,17+,18+,21-,22-,23-,24+,25-/m0/s1 |
| InChIKey | YZDUQOWLRHRPDG-VTYYJGEBSA-N |
| XLogP | 3.03 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|