C11H16N2O2 — CID 91095032
2-morpholin-4-yl-2-pyridin-2-ylethanol (PubChem CID 91095032) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-morpholin-4-yl-2-pyridin-2-ylethanol.
| Compound Name | 2-morpholin-4-yl-2-pyridin-2-ylethanol |
|---|---|
| PubChem CID | 91095032 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-morpholin-4-yl-2-pyridin-2-ylethanol |
| SMILES | OCC(c1ccccn1)N1CCOCC1 |
| InChI | InChI=1S/C11H16N2O2/c14-9-11(10-3-1-2-4-12-10)13-5-7-15-8-6-13/h1-4,11,14H,5-9H2 |
| InChIKey | CDACXRVADDTBEL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |