About methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate
methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate (PubChem CID 91095118) has the molecular formula C18H23F3N2O5S
and a molecular weight of 436.45 g/mol. Its IUPAC name is methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate.
Molecular Properties
| Compound Name | methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate |
| PubChem CID | 91095118 |
| Molecular Formula | C18H23F3N2O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)c1ccc2c(c1)nc(CC(C)(C)C)n2CCOC(F)(F)F |
| InChI | InChI=1S/C18H23F3N2O5S/c1-17(2,3)10-15-22-13-9-12(29(25,26)11-16(24)27-4)5-6-14(13)23(15)7-8-28-18(19,20)21/h5-6,9H,7-8,10-11H2,1-4H3 |
| InChIKey | BARNWMDBVQAJLH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate?
The IUPAC name of methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate (CID 91095118) is methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate.
What is the SMILES notation for methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate?
The canonical SMILES for methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate is COC(=O)CS(=O)(=O)c1ccc2c(c1)nc(CC(C)(C)C)n2CCOC(F)(F)F.
What is the InChIKey of methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate?
The InChIKey is BARNWMDBVQAJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F3N2O5S/c1-17(2,3)10-15-22-13-9-12(29(25,26)11-16(24)27-4)5-6-14(13)23(15)7-8-28-18(19,20)21/h5-6,9H,7-8,10-11H2,1-4H3.
What are the key properties of methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate?
methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate has a molecular weight of 436.45 g/mol, XLogP of 3.11, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(2,2-dimethylpropyl)-1-[2-(trifluoromethoxy)ethyl]benzimidazol-5-yl]sulfonylacetate is sourced from PubChem (CID 91095118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).