About ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate
ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate (PubChem CID 91095139) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate |
| PubChem CID | 91095139 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate |
| SMILES | [H]/N=C1\N=C(N)CCC1C(=O)OCC |
| InChI | InChI=1S/C8H13N3O2/c1-2-13-8(12)5-3-4-6(9)11-7(5)10/h5H,2-4H2,1H3,(H3,9,10,11) |
| InChIKey | ZMHMDLHDDVUJPV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate?
The IUPAC name of ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate (CID 91095139) is ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate?
The canonical SMILES for ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate is [H]/N=C1\N=C(N)CCC1C(=O)OCC.
What is the InChIKey of ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate?
The InChIKey is ZMHMDLHDDVUJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-2-13-8(12)5-3-4-6(9)11-7(5)10/h5H,2-4H2,1H3,(H3,9,10,11).
What are the key properties of ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate?
ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate has a molecular weight of 183.21 g/mol, XLogP of 0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-amino-2-imino-4,5-dihydro-3H-pyridine-3-carboxylate is sourced from PubChem (CID 91095139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).