About 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol
3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol (PubChem CID 91095511) has the molecular formula C17H22N2O3
and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol.
Molecular Properties
| Compound Name | 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol |
| PubChem CID | 91095511 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol |
| SMILES | Cc1cc(CC2C(O)COC2O)nc(-n2c(C)ccc2C)c1 |
| InChI | InChI=1S/C17H22N2O3/c1-10-6-13(8-14-15(20)9-22-17(14)21)18-16(7-10)19-11(2)4-5-12(19)3/h4-7,14-15,17,20-21H,8-9H2,1-3H3 |
| InChIKey | VTNSHVSGDCXJQN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol?
The IUPAC name of 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol (CID 91095511) is 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol.
What is the SMILES notation for 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol?
The canonical SMILES for 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol is Cc1cc(CC2C(O)COC2O)nc(-n2c(C)ccc2C)c1.
What is the InChIKey of 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol?
The InChIKey is VTNSHVSGDCXJQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O3/c1-10-6-13(8-14-15(20)9-22-17(14)21)18-16(7-10)19-11(2)4-5-12(19)3/h4-7,14-15,17,20-21H,8-9H2,1-3H3.
What are the key properties of 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol?
3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol has a molecular weight of 302.37 g/mol, XLogP of 1.67, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]methyl]oxolane-2,4-diol is sourced from PubChem (CID 91095511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).