About tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate
tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate (PubChem CID 91096170) has the molecular formula C19H30N2O4S
and a molecular weight of 382.53 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate |
| PubChem CID | 91096170 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate |
| SMILES | CC(O)c1ccc2c(c1)SCCN2CCN(CCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O4S/c1-14(23)15-5-6-16-17(13-15)26-12-10-20(16)7-8-21(9-11-22)18(24)25-19(2,3)4/h5-6,13-14,22-23H,7-12H2,1-4H3 |
| InChIKey | PETRVXDAJDPYHN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate?
The IUPAC name of tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate (CID 91096170) is tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate?
The canonical SMILES for tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate is CC(O)c1ccc2c(c1)SCCN2CCN(CCO)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate?
The InChIKey is PETRVXDAJDPYHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O4S/c1-14(23)15-5-6-16-17(13-15)26-12-10-20(16)7-8-21(9-11-22)18(24)25-19(2,3)4/h5-6,13-14,22-23H,7-12H2,1-4H3.
What are the key properties of tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate?
tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate has a molecular weight of 382.53 g/mol, XLogP of 2.88, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-hydroxyethyl)-N-[2-[7-(1-hydroxyethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]carbamate is sourced from PubChem (CID 91096170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).