C9H14N2O3 — CID 91096612
ethyl 2-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)acetate (PubChem CID 91096612) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl 2-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)acetate.
| Compound Name | ethyl 2-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 91096612 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | ethyl 2-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)acetate |
| SMILES | CCOC(=O)Cc1c(C)[nH]n(C)c1=O |
| InChI | InChI=1S/C9H14N2O3/c1-4-14-8(12)5-7-6(2)10-11(3)9(7)13/h10H,4-5H2,1-3H3 |
| InChIKey | QFYXWGNCFFKVCX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |