About cyclodeca-3,8-diene-1,6-dithiol
cyclodeca-3,8-diene-1,6-dithiol (PubChem CID 91096756) has the molecular formula C10H16S2
and a molecular weight of 200.37 g/mol. Its IUPAC name is cyclodeca-3,8-diene-1,6-dithiol.
Molecular Properties
| Compound Name | cyclodeca-3,8-diene-1,6-dithiol |
| PubChem CID | 91096756 |
| Molecular Formula | C10H16S2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | cyclodeca-3,8-diene-1,6-dithiol |
| SMILES | SC1CC=CCC(S)CC=CC1 |
| InChI | InChI=1S/C10H16S2/c11-9-5-1-2-6-10(12)8-4-3-7-9/h1-4,9-12H,5-8H2 |
| InChIKey | UFALPLBJNUBADR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclodeca-3,8-diene-1,6-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclodeca-3,8-diene-1,6-dithiol?
The IUPAC name of cyclodeca-3,8-diene-1,6-dithiol (CID 91096756) is cyclodeca-3,8-diene-1,6-dithiol.
What is the SMILES notation for cyclodeca-3,8-diene-1,6-dithiol?
The canonical SMILES for cyclodeca-3,8-diene-1,6-dithiol is SC1CC=CCC(S)CC=CC1.
What is the InChIKey of cyclodeca-3,8-diene-1,6-dithiol?
The InChIKey is UFALPLBJNUBADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S2/c11-9-5-1-2-6-10(12)8-4-3-7-9/h1-4,9-12H,5-8H2.
What are the key properties of cyclodeca-3,8-diene-1,6-dithiol?
cyclodeca-3,8-diene-1,6-dithiol has a molecular weight of 200.37 g/mol, XLogP of 3.27, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclodeca-3,8-diene-1,6-dithiol is sourced from PubChem (CID 91096756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).