C40H37BN2O2 — CID 91097207
3-[3-[3-[3-(2,5-dihydropyridin-3-yl)phenyl]-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]pyridine (PubChem CID 91097207) has the molecular formula C40H37BN2O2 and a molecular weight of 588.56 g/mol. Its IUPAC name is 3-[3-[3-[3-(2,5-dihydropyridin-3-yl)phenyl]-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]pyridine.
| Compound Name | 3-[3-[3-[3-(2,5-dihydropyridin-3-yl)phenyl]-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 91097207 |
| Molecular Formula | C40H37BN2O2 |
| Molecular Weight | 588.56 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 3-[3-[3-[3-(2,5-dihydropyridin-3-yl)phenyl]-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]pyridine |
| SMILES | CC1(C)OB(c2cccc(-c3cc(-c4cccc(C5=CCC=NC5)c4)cc(-c4cccc(-c5cccnc5)c4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C40H37BN2O2/c1-39(2)40(3,4)45-41(44-39)38-17-7-14-32(25-38)37-23-35(30-12-5-10-28(20-30)33-15-8-18-42-26-33)22-36(24-37)31-13-6-11-29(21-31)34-16-9-19-43-27-34/h5-8,10-26H,9,27H2,1-4H3 |
| InChIKey | VIYHMKWJBYXCOA-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.56 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|