C28H50O3Si2 — CID 91097308
methyl (8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-triethylsilylundeca-2,4,6-trien-10-ynoate (PubChem CID 91097308) has the molecular formula C28H50O3Si2 and a molecular weight of 490.88 g/mol. Its IUPAC name is methyl (8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-triethylsilylundeca-2,4,6-trien-10-ynoate.
| Compound Name | methyl (8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-triethylsilylundeca-2,4,6-trien-10-ynoate |
|---|---|
| PubChem CID | 91097308 |
| Molecular Formula | C28H50O3Si2 |
| Molecular Weight | 490.88 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | methyl (8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-triethylsilylundeca-2,4,6-trien-10-ynoate |
| SMILES | CC[Si](C#C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=C(C)C=C(C)C=C(C)C(=O)OC)(CC)CC |
| InChI | InChI=1S/C28H50O3Si2/c1-14-33(15-2,16-3)18-17-26(31-32(12,13)28(8,9)10)24(6)20-22(4)19-23(5)21-25(7)27(29)30-11/h19-21,24,26H,14-16H2,1-13H3/t24-,26-/m1/s1 |
| InChIKey | RSCNMJMLNNATKY-AOYPEHQESA-N |
| XLogP | 8.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.88 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|