About 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene
5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene (PubChem CID 91097512) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene |
| PubChem CID | 91097512 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene |
| SMILES | C=C(C)C(CC1=CC=CC(C)C1C)C(C)CC |
| InChI | InChI=1S/C17H28/c1-7-13(4)17(12(2)3)11-16-10-8-9-14(5)15(16)6/h8-10,13-15,17H,2,7,11H2,1,3-6H3 |
| InChIKey | IOSFANMIKSEKST-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene?
The IUPAC name of 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene (CID 91097512) is 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene.
What is the SMILES notation for 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene?
The canonical SMILES for 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene is C=C(C)C(CC1=CC=CC(C)C1C)C(C)CC.
What is the InChIKey of 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene?
The InChIKey is IOSFANMIKSEKST-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-7-13(4)17(12(2)3)11-16-10-8-9-14(5)15(16)6/h8-10,13-15,17H,2,7,11H2,1,3-6H3.
What are the key properties of 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene?
5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene has a molecular weight of 232.41 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-1-(3-methyl-2-prop-1-en-2-ylpentyl)cyclohexa-1,3-diene is sourced from PubChem (CID 91097512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).