About 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole
3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole (PubChem CID 91098240) has the molecular formula C11H17ClN2
and a molecular weight of 212.72 g/mol. Its IUPAC name is 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole.
Molecular Properties
| Compound Name | 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole |
| PubChem CID | 91098240 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole |
| SMILES | Cn1nc(CCl)c2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C11H17ClN2/c1-11(2)5-4-8-9(7-12)13-14(3)10(8)6-11/h4-7H2,1-3H3 |
| InChIKey | IJQLGBONWIAZCR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole?
The IUPAC name of 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole (CID 91098240) is 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole.
What is the SMILES notation for 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole?
The canonical SMILES for 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole is Cn1nc(CCl)c2c1CC(C)(C)CC2.
What is the InChIKey of 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole?
The InChIKey is IJQLGBONWIAZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2/c1-11(2)5-4-8-9(7-12)13-14(3)10(8)6-11/h4-7H2,1-3H3.
What are the key properties of 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole?
3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole has a molecular weight of 212.72 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-1,6,6-trimethyl-5,7-dihydro-4H-indazole is sourced from PubChem (CID 91098240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).